C12H15F2N3 — CID 104683398
4-(4,5-difluoro-1H-benzimidazol-2-yl)pentan-1-amine (PubChem CID 104683398) has the molecular formula C12H15F2N3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 4-(4,5-difluoro-1H-benzimidazol-2-yl)pentan-1-amine.
| Compound Name | 4-(4,5-difluoro-1H-benzimidazol-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 104683398 |
| Molecular Formula | C12H15F2N3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4-(4,5-difluoro-1H-benzimidazol-2-yl)pentan-1-amine |
| SMILES | CC(CCCN)c1nc2c(F)c(F)ccc2[nH]1 |
| InChI | InChI=1S/C12H15F2N3/c1-7(3-2-6-15)12-16-9-5-4-8(13)10(14)11(9)17-12/h4-5,7H,2-3,6,15H2,1H3,(H,16,17) |
| InChIKey | UIBCIBBBCOFUOH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |