C12H15ClFN3 — CID 114271711
1-(5-chloro-4-fluoro-1H-benzimidazol-2-yl)-2-methylbutan-1-amine (PubChem CID 114271711) has the molecular formula C12H15ClFN3 and a molecular weight of 255.72 g/mol. Its IUPAC name is 1-(5-chloro-4-fluoro-1H-benzimidazol-2-yl)-2-methylbutan-1-amine.
| Compound Name | 1-(5-chloro-4-fluoro-1H-benzimidazol-2-yl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 114271711 |
| Molecular Formula | C12H15ClFN3 |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-(5-chloro-4-fluoro-1H-benzimidazol-2-yl)-2-methylbutan-1-amine |
| SMILES | CCC(C)C(N)c1nc2c(F)c(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C12H15ClFN3/c1-3-6(2)10(15)12-16-8-5-4-7(13)9(14)11(8)17-12/h4-6,10H,3,15H2,1-2H3,(H,16,17) |
| InChIKey | BKSJLXOPUVRKFO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |