C15H20F2N2 — CID 112556805
4,5-difluoro-2-(2,4,4-trimethylpentyl)-1H-benzimidazole (PubChem CID 112556805) has the molecular formula C15H20F2N2 and a molecular weight of 266.33 g/mol. Its IUPAC name is 4,5-difluoro-2-(2,4,4-trimethylpentyl)-1H-benzimidazole.
| Compound Name | 4,5-difluoro-2-(2,4,4-trimethylpentyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 112556805 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4,5-difluoro-2-(2,4,4-trimethylpentyl)-1H-benzimidazole |
| SMILES | CC(Cc1nc2c(F)c(F)ccc2[nH]1)CC(C)(C)C |
| InChI | InChI=1S/C15H20F2N2/c1-9(8-15(2,3)4)7-12-18-11-6-5-10(16)13(17)14(11)19-12/h5-6,9H,7-8H2,1-4H3,(H,18,19) |
| InChIKey | GZLHBZNZYSAKFX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |