C9H8Cl3N3 — CID 10470115
N-(2,4,6-trichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 10470115) has the molecular formula C9H8Cl3N3 and a molecular weight of 264.54 g/mol. Its IUPAC name is N-(2,4,6-trichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(2,4,6-trichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 10470115 |
| Molecular Formula | C9H8Cl3N3 |
| Molecular Weight | 264.54 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | N-(2,4,6-trichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | Clc1cc(Cl)c(NC2=NCCN2)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl3N3/c10-5-3-6(11)8(7(12)4-5)15-9-13-1-2-14-9/h3-4H,1-2H2,(H2,13,14,15) |
| InChIKey | REGMPMOUDUTRSJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |