C13H13ClF3NO3 — CID 104701540
benzyl N-(3-chloro-2-oxopropyl)-N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 104701540) has the molecular formula C13H13ClF3NO3 and a molecular weight of 323.70 g/mol. Its IUPAC name is benzyl N-(3-chloro-2-oxopropyl)-N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | benzyl N-(3-chloro-2-oxopropyl)-N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 104701540 |
| Molecular Formula | C13H13ClF3NO3 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | benzyl N-(3-chloro-2-oxopropyl)-N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(CCl)CN(CC(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H13ClF3NO3/c14-6-11(19)7-18(9-13(15,16)17)12(20)21-8-10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | RIGAPDJCEVHUDY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|