C11H10N6S — CID 104717549
2-amino-3-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile (PubChem CID 104717549) has the molecular formula C11H10N6S and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-amino-3-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile.
| Compound Name | 2-amino-3-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile |
|---|---|
| PubChem CID | 104717549 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-amino-3-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile |
| SMILES | N#Cc1cccc(Sc2nc(N)cc(N)n2)c1N |
| InChI | InChI=1S/C11H10N6S/c12-5-6-2-1-3-7(10(6)15)18-11-16-8(13)4-9(14)17-11/h1-4H,15H2,(H4,13,14,16,17) |
| InChIKey | HTDFWNSCLAZMAH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|