C17H18FN3O3 — CID 10471883
N-ethyl-2-[(4-fluorophenyl)methyl]-1,8-dioxo-4,8a-dihydro-3H-pyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 10471883) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is N-ethyl-2-[(4-fluorophenyl)methyl]-1,8-dioxo-4,8a-dihydro-3H-pyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | N-ethyl-2-[(4-fluorophenyl)methyl]-1,8-dioxo-4,8a-dihydro-3H-pyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 10471883 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-ethyl-2-[(4-fluorophenyl)methyl]-1,8-dioxo-4,8a-dihydro-3H-pyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CCNC(=O)C1=CN2CCN(Cc3ccc(F)cc3)C(=O)C2C1=O |
| InChI | InChI=1S/C17H18FN3O3/c1-2-19-16(23)13-10-20-7-8-21(17(24)14(20)15(13)22)9-11-3-5-12(18)6-4-11/h3-6,10,14H,2,7-9H2,1H3,(H,19,23) |
| InChIKey | RRGDODGLDGXEKZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|