C19H25NO4 — CID 10471898
tert-butyl 4-[(2S,3S)-3-ethyl-4-oxo-3-prop-2-enylazetidin-2-yl]oxybenzoate (PubChem CID 10471898) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is tert-butyl 4-[(2S,3S)-3-ethyl-4-oxo-3-prop-2-enylazetidin-2-yl]oxybenzoate.
| Compound Name | tert-butyl 4-[(2S,3S)-3-ethyl-4-oxo-3-prop-2-enylazetidin-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 10471898 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | tert-butyl 4-[(2S,3S)-3-ethyl-4-oxo-3-prop-2-enylazetidin-2-yl]oxybenzoate |
| SMILES | C=CC[C@]1(CC)C(=O)N[C@H]1Oc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-6-12-19(7-2)16(22)20-17(19)23-14-10-8-13(9-11-14)15(21)24-18(3,4)5/h6,8-11,17H,1,7,12H2,2-5H3,(H,20,22)/t17-,19+/m0/s1 |
| InChIKey | FPGKHCQKAMGVIV-PKOBYXMFSA-N |
| XLogP | 3.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|