C13H18N6O5 — CID 10472290
4-amino-7-[(2R,3R,4R,5R)-5-(2-amino-1-hydroxyethyl)-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 10472290) has the molecular formula C13H18N6O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is 4-amino-7-[(2R,3R,4R,5R)-5-(2-amino-1-hydroxyethyl)-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-7-[(2R,3R,4R,5R)-5-(2-amino-1-hydroxyethyl)-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10472290 |
| Molecular Formula | C13H18N6O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-amino-7-[(2R,3R,4R,5R)-5-(2-amino-1-hydroxyethyl)-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | NCC(O)[C@H]1O[C@@H](n2cc(C(N)=O)c3c(N)ncnc32)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18N6O5/c14-1-5(20)9-7(21)8(22)13(24-9)19-2-4(11(16)23)6-10(15)17-3-18-12(6)19/h2-3,5,7-9,13,20-22H,1,14H2,(H2,16,23)(H2,15,17,18)/t5?,7-,8-,9-,13-/m1/s1 |
| InChIKey | PZVJSGJXRWDLNN-BFHTUGQXSA-N |
| XLogP | -2.95 |
| TPSA | 195.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |