C13H19N7O — CID 104730286
N'-hydroxy-2-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)propanimidamide (PubChem CID 104730286) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is N'-hydroxy-2-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)propanimidamide.
| Compound Name | N'-hydroxy-2-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)propanimidamide |
|---|---|
| PubChem CID | 104730286 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N'-hydroxy-2-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)propanimidamide |
| SMILES | CC(/C(N)=N/O)N1CCN(c2nccn3nccc23)CC1 |
| InChI | InChI=1S/C13H19N7O/c1-10(12(14)17-21)18-6-8-19(9-7-18)13-11-2-3-16-20(11)5-4-15-13/h2-5,10,21H,6-9H2,1H3,(H2,14,17) |
| InChIKey | ADEKWLWLECJEOF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|