C18H17N3O4S — CID 10474369
4-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzimidazol-1-yl]cyclohexane-1-carboxylic acid (PubChem CID 10474369) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzimidazol-1-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzimidazol-1-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 10474369 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzimidazol-1-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3ncn(C4CCC(C(=O)O)CC4)c3c2)S1 |
| InChI | InChI=1S/C18H17N3O4S/c22-16-15(26-18(25)20-16)8-10-1-6-13-14(7-10)21(9-19-13)12-4-2-11(3-5-12)17(23)24/h1,6-9,11-12H,2-5H2,(H,23,24)(H,20,22,25)/b15-8+ |
| InChIKey | MOZTXPZQYHNCJW-OVCLIPMQSA-N |
| XLogP | 3.18 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|