C8H14N4O — CID 104747084
1-(oxolan-3-yl)-2-(1,2,4-triazol-1-yl)ethanamine (PubChem CID 104747084) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-2-(1,2,4-triazol-1-yl)ethanamine.
| Compound Name | 1-(oxolan-3-yl)-2-(1,2,4-triazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 104747084 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-(oxolan-3-yl)-2-(1,2,4-triazol-1-yl)ethanamine |
| SMILES | NC(Cn1cncn1)C1CCOC1 |
| InChI | InChI=1S/C8H14N4O/c9-8(7-1-2-13-4-7)3-12-6-10-5-11-12/h5-8H,1-4,9H2 |
| InChIKey | OTNBSOVLZDJTLB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |