C17H32N2O4S2 — CID 10475641
N'-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]methanedisulfonamide (PubChem CID 10475641) has the molecular formula C17H32N2O4S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is N'-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]methanedisulfonamide.
| Compound Name | N'-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]methanedisulfonamide |
|---|---|
| PubChem CID | 10475641 |
| Molecular Formula | C17H32N2O4S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N'-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]methanedisulfonamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCNS(=O)(=O)CS(N)(=O)=O |
| InChI | InChI=1S/C17H32N2O4S2/c1-15(2)8-5-9-16(3)10-6-11-17(4)12-7-13-19-25(22,23)14-24(18,20)21/h8,10,12,19H,5-7,9,11,13-14H2,1-4H3,(H2,18,20,21)/b16-10+,17-12+ |
| InChIKey | RUJMKDQXQHRAAN-JTCWOHKRSA-N |
| XLogP | 2.96 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|