C9H20N2O4S — CID 104759974
1-amino-N-[(3-methoxyoxolan-3-yl)methyl]propane-2-sulfonamide (PubChem CID 104759974) has the molecular formula C9H20N2O4S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-amino-N-[(3-methoxyoxolan-3-yl)methyl]propane-2-sulfonamide.
| Compound Name | 1-amino-N-[(3-methoxyoxolan-3-yl)methyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 104759974 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-amino-N-[(3-methoxyoxolan-3-yl)methyl]propane-2-sulfonamide |
| SMILES | COC1(CNS(=O)(=O)C(C)CN)CCOC1 |
| InChI | InChI=1S/C9H20N2O4S/c1-8(5-10)16(12,13)11-6-9(14-2)3-4-15-7-9/h8,11H,3-7,10H2,1-2H3 |
| InChIKey | UJTQDZNEWWEOQK-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |