C8H14N4O2S — CID 104765544
5-amino-N-(2-propan-2-yloxyethyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 104765544) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-amino-N-(2-propan-2-yloxyethyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-amino-N-(2-propan-2-yloxyethyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 104765544 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-amino-N-(2-propan-2-yloxyethyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CC(C)OCCNC(=O)c1nnc(N)s1 |
| InChI | InChI=1S/C8H14N4O2S/c1-5(2)14-4-3-10-6(13)7-11-12-8(9)15-7/h5H,3-4H2,1-2H3,(H2,9,12)(H,10,13) |
| InChIKey | IAXQFSVGRWVFGZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|