C25H35N3O2 — CID 10476627
(1,4-dibenzylpiperazin-2-yl)methyl N-pentan-2-ylcarbamate (PubChem CID 10476627) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is (1,4-dibenzylpiperazin-2-yl)methyl N-pentan-2-ylcarbamate.
| Compound Name | (1,4-dibenzylpiperazin-2-yl)methyl N-pentan-2-ylcarbamate |
|---|---|
| PubChem CID | 10476627 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | (1,4-dibenzylpiperazin-2-yl)methyl N-pentan-2-ylcarbamate |
| SMILES | CCCC(C)NC(=O)OCC1CN(Cc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C25H35N3O2/c1-3-10-21(2)26-25(29)30-20-24-19-27(17-22-11-6-4-7-12-22)15-16-28(24)18-23-13-8-5-9-14-23/h4-9,11-14,21,24H,3,10,15-20H2,1-2H3,(H,26,29) |
| InChIKey | KWTRDIREWHFRLL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |