C29H35N3O5 — CID 10255609
(1,4-dibenzylpiperazin-2-yl)methyl N-(3,4,5-trimethoxyphenyl)carbamate (PubChem CID 10255609) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is (1,4-dibenzylpiperazin-2-yl)methyl N-(3,4,5-trimethoxyphenyl)carbamate.
| Compound Name | (1,4-dibenzylpiperazin-2-yl)methyl N-(3,4,5-trimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 10255609 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | (1,4-dibenzylpiperazin-2-yl)methyl N-(3,4,5-trimethoxyphenyl)carbamate |
| SMILES | COc1cc(NC(=O)OCC2CN(Cc3ccccc3)CCN2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H35N3O5/c1-34-26-16-24(17-27(35-2)28(26)36-3)30-29(33)37-21-25-20-31(18-22-10-6-4-7-11-22)14-15-32(25)19-23-12-8-5-9-13-23/h4-13,16-17,25H,14-15,18-21H2,1-3H3,(H,30,33) |
| InChIKey | MNGMMADIYFLIST-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |