C18H27NO2 — CID 104772468
(Z)-5-(3,4-dihydro-2H-chromen-4-yl)-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine (PubChem CID 104772468) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (Z)-5-(3,4-dihydro-2H-chromen-4-yl)-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine.
| Compound Name | (Z)-5-(3,4-dihydro-2H-chromen-4-yl)-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 104772468 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (Z)-5-(3,4-dihydro-2H-chromen-4-yl)-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine |
| SMILES | COCCNCC/C=C(/C)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H27NO2/c1-15(6-5-10-19-11-13-20-2)14-16-9-12-21-18-8-4-3-7-17(16)18/h3-4,6-8,16,19H,5,9-14H2,1-2H3/b15-6- |
| InChIKey | BHSSIHCDJQWWSH-UUASQNMZSA-N |
| XLogP | 3.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|