C12H12IN3O — CID 104772475
1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-iodo-1,2,4-triazole (PubChem CID 104772475) has the molecular formula C12H12IN3O and a molecular weight of 341.15 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-iodo-1,2,4-triazole.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-iodo-1,2,4-triazole |
|---|---|
| PubChem CID | 104772475 |
| Molecular Formula | C12H12IN3O |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-iodo-1,2,4-triazole |
| SMILES | Ic1ncn(CC2CCOc3ccccc32)n1 |
| InChI | InChI=1S/C12H12IN3O/c13-12-14-8-16(15-12)7-9-5-6-17-11-4-2-1-3-10(9)11/h1-4,8-9H,5-7H2 |
| InChIKey | IKQPOSFZAFSTTM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|