C14H12ClIN2O2 — CID 114583740
6-chloro-3-(3,4-dihydro-2H-chromen-4-ylmethyl)-5-iodopyrimidin-4-one (PubChem CID 114583740) has the molecular formula C14H12ClIN2O2 and a molecular weight of 402.62 g/mol. Its IUPAC name is 6-chloro-3-(3,4-dihydro-2H-chromen-4-ylmethyl)-5-iodopyrimidin-4-one.
| Compound Name | 6-chloro-3-(3,4-dihydro-2H-chromen-4-ylmethyl)-5-iodopyrimidin-4-one |
|---|---|
| PubChem CID | 114583740 |
| Molecular Formula | C14H12ClIN2O2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 6-chloro-3-(3,4-dihydro-2H-chromen-4-ylmethyl)-5-iodopyrimidin-4-one |
| SMILES | O=c1c(I)c(Cl)ncn1CC1CCOc2ccccc21 |
| InChI | InChI=1S/C14H12ClIN2O2/c15-13-12(16)14(19)18(8-17-13)7-9-5-6-20-11-4-2-1-3-10(9)11/h1-4,8-9H,5-7H2 |
| InChIKey | KIMZWTGSSKRAIB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|