C13H10ClIN2O2 — CID 114583853
6-chloro-3-(2,3-dihydro-1-benzofuran-3-ylmethyl)-5-iodopyrimidin-4-one (PubChem CID 114583853) has the molecular formula C13H10ClIN2O2 and a molecular weight of 388.59 g/mol. Its IUPAC name is 6-chloro-3-(2,3-dihydro-1-benzofuran-3-ylmethyl)-5-iodopyrimidin-4-one.
| Compound Name | 6-chloro-3-(2,3-dihydro-1-benzofuran-3-ylmethyl)-5-iodopyrimidin-4-one |
|---|---|
| PubChem CID | 114583853 |
| Molecular Formula | C13H10ClIN2O2 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 6-chloro-3-(2,3-dihydro-1-benzofuran-3-ylmethyl)-5-iodopyrimidin-4-one |
| SMILES | O=c1c(I)c(Cl)ncn1CC1COc2ccccc21 |
| InChI | InChI=1S/C13H10ClIN2O2/c14-12-11(15)13(18)17(7-16-12)5-8-6-19-10-4-2-1-3-9(8)10/h1-4,7-8H,5-6H2 |
| InChIKey | ZVRKEFPBSTXBIC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|