C14H13ClN2O2 — CID 114582018
6-chloro-3-(3,4-dihydro-2H-chromen-4-ylmethyl)pyrimidin-4-one (PubChem CID 114582018) has the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. Its IUPAC name is 6-chloro-3-(3,4-dihydro-2H-chromen-4-ylmethyl)pyrimidin-4-one.
| Compound Name | 6-chloro-3-(3,4-dihydro-2H-chromen-4-ylmethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114582018 |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 6-chloro-3-(3,4-dihydro-2H-chromen-4-ylmethyl)pyrimidin-4-one |
| SMILES | O=c1cc(Cl)ncn1CC1CCOc2ccccc21 |
| InChI | InChI=1S/C14H13ClN2O2/c15-13-7-14(18)17(9-16-13)8-10-5-6-19-12-4-2-1-3-11(10)12/h1-4,7,9-10H,5-6,8H2 |
| InChIKey | XAGVXFPSDRMOKR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |