C16H18N2O2S — CID 104773721
N-methyl-N-phenyl-1,2,3,4-tetrahydroquinoline-5-sulfonamide (PubChem CID 104773721) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-methyl-N-phenyl-1,2,3,4-tetrahydroquinoline-5-sulfonamide.
| Compound Name | N-methyl-N-phenyl-1,2,3,4-tetrahydroquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 104773721 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-methyl-N-phenyl-1,2,3,4-tetrahydroquinoline-5-sulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc2c1CCCN2 |
| InChI | InChI=1S/C16H18N2O2S/c1-18(13-7-3-2-4-8-13)21(19,20)16-11-5-10-15-14(16)9-6-12-17-15/h2-5,7-8,10-11,17H,6,9,12H2,1H3 |
| InChIKey | BTOXIXMHNDNAIC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |