C16H24N2O2S — CID 104773900
N-(1-cyclopentylethyl)-1,2,3,4-tetrahydroquinoline-5-sulfonamide (PubChem CID 104773900) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-(1-cyclopentylethyl)-1,2,3,4-tetrahydroquinoline-5-sulfonamide.
| Compound Name | N-(1-cyclopentylethyl)-1,2,3,4-tetrahydroquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 104773900 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-(1-cyclopentylethyl)-1,2,3,4-tetrahydroquinoline-5-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccc2c1CCCN2)C1CCCC1 |
| InChI | InChI=1S/C16H24N2O2S/c1-12(13-6-2-3-7-13)18-21(19,20)16-10-4-9-15-14(16)8-5-11-17-15/h4,9-10,12-13,17-18H,2-3,5-8,11H2,1H3 |
| InChIKey | LSYDVJPQFJISBT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |