C26H25ClN2S — CID 10477958
2-[(1E,3E)-4-(3,4-dihydro-2H-quinolin-1-yl)buta-1,3-dienyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium chloride (PubChem CID 10477958) has the molecular formula C26H25ClN2S and a molecular weight of 433.02 g/mol. Its IUPAC name is 2-[(1E,3E)-4-(3,4-dihydro-2H-quinolin-1-yl)buta-1,3-dienyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium chloride.
| Compound Name | 2-[(1E,3E)-4-(3,4-dihydro-2H-quinolin-1-yl)buta-1,3-dienyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium chloride |
|---|---|
| PubChem CID | 10477958 |
| Molecular Formula | C26H25ClN2S |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[(1E,3E)-4-(3,4-dihydro-2H-quinolin-1-yl)buta-1,3-dienyl]-1-ethylbenzo[e][1,3]benzothiazol-1-ium chloride |
| SMILES | CC[n+]1c(/C=C/C=C/N2CCCc3ccccc32)sc2ccc3ccccc3c21.[Cl-] |
| InChI | InChI=1S/C26H25N2S.ClH/c1-2-28-25(29-24-17-16-20-10-3-5-13-22(20)26(24)28)15-7-8-18-27-19-9-12-21-11-4-6-14-23(21)27;/h3-8,10-11,13-18H,2,9,12,19H2,1H3;1H/q+1;/p-1 |
| InChIKey | OOWVSTOMAQDMOU-UHFFFAOYSA-M |
| XLogP | 3.35 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|