C7H5FN4O — CID 104786443
5-(5-fluoro-3-pyridinyl)-1,2,4-oxadiazol-3-amine (PubChem CID 104786443) has the molecular formula C7H5FN4O and a molecular weight of 180.14 g/mol. Its IUPAC name is 5-(5-fluoro-3-pyridinyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(5-fluoro-3-pyridinyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 104786443 |
| Molecular Formula | C7H5FN4O |
| Molecular Weight | 180.14 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 5-(5-fluoro-3-pyridinyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(-c2cncc(F)c2)n1 |
| InChI | InChI=1S/C7H5FN4O/c8-5-1-4(2-10-3-5)6-11-7(9)12-13-6/h1-3H,(H2,9,12) |
| InChIKey | QKJYIBTYTJYCHA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.14 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |