C11H13FN4 — CID 104786808
3-(4-tert-butyl-1,2,4-triazol-3-yl)-5-fluoropyridine (PubChem CID 104786808) has the molecular formula C11H13FN4 and a molecular weight of 220.25 g/mol. Its IUPAC name is 3-(4-tert-butyl-1,2,4-triazol-3-yl)-5-fluoropyridine.
| Compound Name | 3-(4-tert-butyl-1,2,4-triazol-3-yl)-5-fluoropyridine |
|---|---|
| PubChem CID | 104786808 |
| Molecular Formula | C11H13FN4 |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3-(4-tert-butyl-1,2,4-triazol-3-yl)-5-fluoropyridine |
| SMILES | CC(C)(C)n1cnnc1-c1cncc(F)c1 |
| InChI | InChI=1S/C11H13FN4/c1-11(2,3)16-7-14-15-10(16)8-4-9(12)6-13-5-8/h4-7H,1-3H3 |
| InChIKey | AVCJLWHSVXFSLI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |