C20H19FN4O5S — CID 10478726
[1-(4-fluorophenyl)sulfonyl-5-nitroindol-3-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 10478726) has the molecular formula C20H19FN4O5S and a molecular weight of 446.46 g/mol. Its IUPAC name is [1-(4-fluorophenyl)sulfonyl-5-nitroindol-3-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [1-(4-fluorophenyl)sulfonyl-5-nitroindol-3-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 10478726 |
| Molecular Formula | C20H19FN4O5S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | [1-(4-fluorophenyl)sulfonyl-5-nitroindol-3-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cn(S(=O)(=O)c3ccc(F)cc3)c3ccc([N+](=O)[O-])cc23)CC1 |
| InChI | InChI=1S/C20H19FN4O5S/c1-22-8-10-23(11-9-22)20(26)18-13-24(19-7-4-15(25(27)28)12-17(18)19)31(29,30)16-5-2-14(21)3-6-16/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | UEMFHQFJMMNSGC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 105.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|