About 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one
3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one (PubChem CID 104787902) has the molecular formula C11H13N3O
and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one |
| PubChem CID | 104787902 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one |
| SMILES | O=C1C=C(N2CCn3ccnc3C2)CC1 |
| InChI | InChI=1S/C11H13N3O/c15-10-2-1-9(7-10)14-6-5-13-4-3-12-11(13)8-14/h3-4,7H,1-2,5-6,8H2 |
| InChIKey | RHIORZPZEDJZRP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one?
The IUPAC name of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one (CID 104787902) is 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one.
What is the SMILES notation for 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one?
The canonical SMILES for 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one is O=C1C=C(N2CCn3ccnc3C2)CC1.
What is the InChIKey of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one?
The InChIKey is RHIORZPZEDJZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c15-10-2-1-9(7-10)14-6-5-13-4-3-12-11(13)8-14/h3-4,7H,1-2,5-6,8H2.
What are the key properties of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one?
3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one has a molecular weight of 203.24 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopent-2-en-1-one is sourced from PubChem (CID 104787902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).