C12H20N2O2 — CID 104788692
N-tert-butyl-2-[(3-oxocyclopenten-1-yl)amino]propanamide (PubChem CID 104788692) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N-tert-butyl-2-[(3-oxocyclopenten-1-yl)amino]propanamide.
| Compound Name | N-tert-butyl-2-[(3-oxocyclopenten-1-yl)amino]propanamide |
|---|---|
| PubChem CID | 104788692 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-tert-butyl-2-[(3-oxocyclopenten-1-yl)amino]propanamide |
| SMILES | CC(NC1=CC(=O)CC1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H20N2O2/c1-8(11(16)14-12(2,3)4)13-9-5-6-10(15)7-9/h7-8,13H,5-6H2,1-4H3,(H,14,16) |
| InChIKey | LGSUPIYYCVVJKM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |