C12H15NOS — CID 104791114
4-tert-butyl-2-(2-methylfuran-3-yl)-1,3-thiazole (PubChem CID 104791114) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 4-tert-butyl-2-(2-methylfuran-3-yl)-1,3-thiazole.
| Compound Name | 4-tert-butyl-2-(2-methylfuran-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 104791114 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-tert-butyl-2-(2-methylfuran-3-yl)-1,3-thiazole |
| SMILES | Cc1occc1-c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C12H15NOS/c1-8-9(5-6-14-8)11-13-10(7-15-11)12(2,3)4/h5-7H,1-4H3 |
| InChIKey | LIUUERDRRBVQGR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |