C27H34N2O5 — CID 10479667
4-[3,3-diethyl-4-oxo-1-(6-phenylhexylcarbamoyl)azetidin-2-yl]oxybenzoic acid (PubChem CID 10479667) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is 4-[3,3-diethyl-4-oxo-1-(6-phenylhexylcarbamoyl)azetidin-2-yl]oxybenzoic acid.
| Compound Name | 4-[3,3-diethyl-4-oxo-1-(6-phenylhexylcarbamoyl)azetidin-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 10479667 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 4-[3,3-diethyl-4-oxo-1-(6-phenylhexylcarbamoyl)azetidin-2-yl]oxybenzoic acid |
| SMILES | CCC1(CC)C(=O)N(C(=O)NCCCCCCc2ccccc2)C1Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H34N2O5/c1-3-27(4-2)24(32)29(25(27)34-22-17-15-21(16-18-22)23(30)31)26(33)28-19-11-6-5-8-12-20-13-9-7-10-14-20/h7,9-10,13-18,25H,3-6,8,11-12,19H2,1-2H3,(H,28,33)(H,30,31) |
| InChIKey | HVVVIISNVRPGCR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|