C26H29F3N2O5 — CID 68732322
4-[(2S)-3,3-diethyl-4-oxo-1-[4-[4-(trifluoromethyl)phenyl]butylcarbamoyl]azetidin-2-yl]oxybenzoic acid (PubChem CID 68732322) has the molecular formula C26H29F3N2O5 and a molecular weight of 506.52 g/mol. Its IUPAC name is 4-[(2S)-3,3-diethyl-4-oxo-1-[4-[4-(trifluoromethyl)phenyl]butylcarbamoyl]azetidin-2-yl]oxybenzoic acid.
| Compound Name | 4-[(2S)-3,3-diethyl-4-oxo-1-[4-[4-(trifluoromethyl)phenyl]butylcarbamoyl]azetidin-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 68732322 |
| Molecular Formula | C26H29F3N2O5 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 4-[(2S)-3,3-diethyl-4-oxo-1-[4-[4-(trifluoromethyl)phenyl]butylcarbamoyl]azetidin-2-yl]oxybenzoic acid |
| SMILES | CCC1(CC)C(=O)N(C(=O)NCCCCc2ccc(C(F)(F)F)cc2)[C@H]1Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H29F3N2O5/c1-3-25(4-2)22(34)31(23(25)36-20-14-10-18(11-15-20)21(32)33)24(35)30-16-6-5-7-17-8-12-19(13-9-17)26(27,28)29/h8-15,23H,3-7,16H2,1-2H3,(H,30,35)(H,32,33)/t23-/m0/s1 |
| InChIKey | RKYFJUAJJGCYPS-QHCPKHFHSA-N |
| XLogP | 5.49 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|