C33H33F3N2O5 — CID 68732205
benzyl 4-[(2S)-3,3-diethyl-4-oxo-1-[4-[4-(trifluoromethyl)phenyl]but-3-enylcarbamoyl]azetidin-2-yl]oxybenzoate (PubChem CID 68732205) has the molecular formula C33H33F3N2O5 and a molecular weight of 594.63 g/mol. Its IUPAC name is benzyl 4-[(2S)-3,3-diethyl-4-oxo-1-[4-[4-(trifluoromethyl)phenyl]but-3-enylcarbamoyl]azetidin-2-yl]oxybenzoate.
| Compound Name | benzyl 4-[(2S)-3,3-diethyl-4-oxo-1-[4-[4-(trifluoromethyl)phenyl]but-3-enylcarbamoyl]azetidin-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 68732205 |
| Molecular Formula | C33H33F3N2O5 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | benzyl 4-[(2S)-3,3-diethyl-4-oxo-1-[4-[4-(trifluoromethyl)phenyl]but-3-enylcarbamoyl]azetidin-2-yl]oxybenzoate |
| SMILES | CCC1(CC)C(=O)N(C(=O)NCCC=Cc2ccc(C(F)(F)F)cc2)[C@H]1Oc1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H33F3N2O5/c1-3-32(4-2)29(40)38(31(41)37-21-9-8-10-23-13-17-26(18-14-23)33(34,35)36)30(32)43-27-19-15-25(16-20-27)28(39)42-22-24-11-6-5-7-12-24/h5-8,10-20,30H,3-4,9,21-22H2,1-2H3,(H,37,41)/t30-/m0/s1 |
| InChIKey | RILHBFYLMGZMAF-PMERELPUSA-N |
| XLogP | 7.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|