C10H9NO2S — CID 104806298
1-[2-(3-methylfuran-2-yl)-1,3-thiazol-5-yl]ethanone (PubChem CID 104806298) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 1-[2-(3-methylfuran-2-yl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(3-methylfuran-2-yl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 104806298 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 1-[2-(3-methylfuran-2-yl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(-c2occc2C)s1 |
| InChI | InChI=1S/C10H9NO2S/c1-6-3-4-13-9(6)10-11-5-8(14-10)7(2)12/h3-5H,1-2H3 |
| InChIKey | HXSNXWZRDOQMDI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |