C10H11NOS — CID 104808043
5-ethyl-2-(3-methylfuran-2-yl)-1,3-thiazole (PubChem CID 104808043) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 5-ethyl-2-(3-methylfuran-2-yl)-1,3-thiazole.
| Compound Name | 5-ethyl-2-(3-methylfuran-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 104808043 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 5-ethyl-2-(3-methylfuran-2-yl)-1,3-thiazole |
| SMILES | CCc1cnc(-c2occc2C)s1 |
| InChI | InChI=1S/C10H11NOS/c1-3-8-6-11-10(13-8)9-7(2)4-5-12-9/h4-6H,3H2,1-2H3 |
| InChIKey | CKBNTCRLJPCHLA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |