C9H9NOS — CID 104808022
4-methyl-2-(3-methylfuran-2-yl)-1,3-thiazole (PubChem CID 104808022) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 4-methyl-2-(3-methylfuran-2-yl)-1,3-thiazole.
| Compound Name | 4-methyl-2-(3-methylfuran-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 104808022 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 4-methyl-2-(3-methylfuran-2-yl)-1,3-thiazole |
| SMILES | Cc1csc(-c2occc2C)n1 |
| InChI | InChI=1S/C9H9NOS/c1-6-3-4-11-8(6)9-10-7(2)5-12-9/h3-5H,1-2H3 |
| InChIKey | RMKBKZGLKILKEA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |