C19H25NO12S — CID 10480765
[(2R,3S)-3-[(4S,5R)-3-acetyl-5,6-diacetyloxy-2-sulfanylidene-1,3-oxazinan-4-yl]-2,3-diacetyloxypropyl] acetate (PubChem CID 10480765) has the molecular formula C19H25NO12S and a molecular weight of 491.47 g/mol. Its IUPAC name is [(2R,3S)-3-[(4S,5R)-3-acetyl-5,6-diacetyloxy-2-sulfanylidene-1,3-oxazinan-4-yl]-2,3-diacetyloxypropyl] acetate.
| Compound Name | [(2R,3S)-3-[(4S,5R)-3-acetyl-5,6-diacetyloxy-2-sulfanylidene-1,3-oxazinan-4-yl]-2,3-diacetyloxypropyl] acetate |
|---|---|
| PubChem CID | 10480765 |
| Molecular Formula | C19H25NO12S |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | [(2R,3S)-3-[(4S,5R)-3-acetyl-5,6-diacetyloxy-2-sulfanylidene-1,3-oxazinan-4-yl]-2,3-diacetyloxypropyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1[C@@H](OC(C)=O)C(OC(C)=O)OC(=S)N1C(C)=O |
| InChI | InChI=1S/C19H25NO12S/c1-8(21)20-15(17(30-12(5)25)18(31-13(6)26)32-19(20)33)16(29-11(4)24)14(28-10(3)23)7-27-9(2)22/h14-18H,7H2,1-6H3/t14-,15+,16-,17-,18?/m1/s1 |
| InChIKey | SJHYYWJWMNKWGV-NLFSOYADSA-N |
| XLogP | -0.23 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|