C11H17N3 — CID 104811561
(3,5-dimethyl-1-pent-3-ynylpyrazol-4-yl)methanamine (PubChem CID 104811561) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (3,5-dimethyl-1-pent-3-ynylpyrazol-4-yl)methanamine.
| Compound Name | (3,5-dimethyl-1-pent-3-ynylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 104811561 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (3,5-dimethyl-1-pent-3-ynylpyrazol-4-yl)methanamine |
| SMILES | CC#CCCn1nc(C)c(CN)c1C |
| InChI | InChI=1S/C11H17N3/c1-4-5-6-7-14-10(3)11(8-12)9(2)13-14/h6-8,12H2,1-3H3 |
| InChIKey | YMCCPINMLGPXKC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|