C13H17FIN3 — CID 104829013
1-(3,3-dimethylbutan-2-yl)-6-fluoro-5-iodobenzimidazol-2-amine (PubChem CID 104829013) has the molecular formula C13H17FIN3 and a molecular weight of 361.20 g/mol. Its IUPAC name is 1-(3,3-dimethylbutan-2-yl)-6-fluoro-5-iodobenzimidazol-2-amine.
| Compound Name | 1-(3,3-dimethylbutan-2-yl)-6-fluoro-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 104829013 |
| Molecular Formula | C13H17FIN3 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 1-(3,3-dimethylbutan-2-yl)-6-fluoro-5-iodobenzimidazol-2-amine |
| SMILES | CC(n1c(N)nc2cc(I)c(F)cc21)C(C)(C)C |
| InChI | InChI=1S/C13H17FIN3/c1-7(13(2,3)4)18-11-5-8(14)9(15)6-10(11)17-12(18)16/h5-7H,1-4H3,(H2,16,17) |
| InChIKey | WGWZFSGPDSOJBH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|