C13H15FIN3 — CID 113488932
1-(1-ethylcyclobutyl)-6-fluoro-5-iodobenzimidazol-2-amine (PubChem CID 113488932) has the molecular formula C13H15FIN3 and a molecular weight of 359.19 g/mol. Its IUPAC name is 1-(1-ethylcyclobutyl)-6-fluoro-5-iodobenzimidazol-2-amine.
| Compound Name | 1-(1-ethylcyclobutyl)-6-fluoro-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 113488932 |
| Molecular Formula | C13H15FIN3 |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 1-(1-ethylcyclobutyl)-6-fluoro-5-iodobenzimidazol-2-amine |
| SMILES | CCC1(n2c(N)nc3cc(I)c(F)cc32)CCC1 |
| InChI | InChI=1S/C13H15FIN3/c1-2-13(4-3-5-13)18-11-6-8(14)9(15)7-10(11)17-12(18)16/h6-7H,2-5H2,1H3,(H2,16,17) |
| InChIKey | VLOHGGPCJBPKKM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|