C29H41N3O4S2 — CID 10482919
3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione (PubChem CID 10482919) has the molecular formula C29H41N3O4S2 and a molecular weight of 559.80 g/mol. Its IUPAC name is 3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10482919 |
| Molecular Formula | C29H41N3O4S2 |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
| SMILES | CSCCC1NC(=O)N([C@H]2C[C@H]3CC[C@]2(CS(=O)(=O)N2CCC4(CCc5ccccc54)CC2)C3(C)C)C1=O |
| InChI | InChI=1S/C29H41N3O4S2/c1-27(2)21-9-12-29(27,24(18-21)32-25(33)23(10-17-37-3)30-26(32)34)19-38(35,36)31-15-13-28(14-16-31)11-8-20-6-4-5-7-22(20)28/h4-7,21,23-24H,8-19H2,1-3H3,(H,30,34)/t21-,23?,24+,29-/m1/s1 |
| InChIKey | KBOXAMMHOWVAMR-AHJBDCKWSA-N |
| XLogP | 4.16 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|