C12H17N3S2 — CID 104841402
N-[[4-ethyl-2-(1,3-thiazol-5-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 104841402) has the molecular formula C12H17N3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is N-[[4-ethyl-2-(1,3-thiazol-5-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-ethyl-2-(1,3-thiazol-5-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 104841402 |
| Molecular Formula | C12H17N3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[[4-ethyl-2-(1,3-thiazol-5-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(-c2cncs2)nc1CC |
| InChI | InChI=1S/C12H17N3S2/c1-3-5-13-6-10-9(4-2)15-12(17-10)11-7-14-8-16-11/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | PJXSGEIKEWJJSB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|