C32H66O6Si3 — CID 10484147
(2E,4S,5S,6E,8S,9S,10E)-8,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(methoxymethoxy)dodeca-2,6,10-trien-5-ol (PubChem CID 10484147) has the molecular formula C32H66O6Si3 and a molecular weight of 631.13 g/mol. Its IUPAC name is (2E,4S,5S,6E,8S,9S,10E)-8,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(methoxymethoxy)dodeca-2,6,10-trien-5-ol.
| Compound Name | (2E,4S,5S,6E,8S,9S,10E)-8,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(methoxymethoxy)dodeca-2,6,10-trien-5-ol |
|---|---|
| PubChem CID | 10484147 |
| Molecular Formula | C32H66O6Si3 |
| Molecular Weight | 631.13 g/mol |
| Exact Mass | 630.42 |
| IUPAC Name | (2E,4S,5S,6E,8S,9S,10E)-8,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(methoxymethoxy)dodeca-2,6,10-trien-5-ol |
| SMILES | C/C=C/[C@H](OCOC)[C@@H](O)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H66O6Si3/c1-18-20-27(35-25-34-11)26(33)22-23-29(38-41(16,17)32(8,9)10)28(37-40(14,15)31(5,6)7)21-19-24-36-39(12,13)30(2,3)4/h18-23,26-29,33H,24-25H2,1-17H3/b20-18+,21-19+,23-22+/t26-,27-,28-,29-/m0/s1 |
| InChIKey | AMGBPVJHMPYESW-ZQODTCOZSA-N |
| XLogP | 8.83 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.13 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|