C21H39NO4Si — CID 134947469
(2Z,5R,6E,8R)-5-hydroxy-8-(methoxymethoxy)-8-methyl-9-tri(propan-2-yl)silyloxynona-2,6-dienenitrile (PubChem CID 134947469) has the molecular formula C21H39NO4Si and a molecular weight of 397.63 g/mol. Its IUPAC name is (2Z,5R,6E,8R)-5-hydroxy-8-(methoxymethoxy)-8-methyl-9-tri(propan-2-yl)silyloxynona-2,6-dienenitrile.
| Compound Name | (2Z,5R,6E,8R)-5-hydroxy-8-(methoxymethoxy)-8-methyl-9-tri(propan-2-yl)silyloxynona-2,6-dienenitrile |
|---|---|
| PubChem CID | 134947469 |
| Molecular Formula | C21H39NO4Si |
| Molecular Weight | 397.63 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (2Z,5R,6E,8R)-5-hydroxy-8-(methoxymethoxy)-8-methyl-9-tri(propan-2-yl)silyloxynona-2,6-dienenitrile |
| SMILES | COCO[C@](C)(/C=C/[C@H](O)C/C=C\C#N)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H39NO4Si/c1-17(2)27(18(3)4,19(5)6)26-15-21(7,25-16-24-8)13-12-20(23)11-9-10-14-22/h9-10,12-13,17-20,23H,11,15-16H2,1-8H3/b10-9-,13-12+/t20-,21-/m1/s1 |
| InChIKey | NHVATBGZKHMSOP-COGJCVOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|