C20H40O4Si — CID 177384026
(4R,7R)-7-(methoxymethoxy)-7-methyl-8-tri(propan-2-yl)silyloxyocta-1,5-dien-4-ol (PubChem CID 177384026) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is (4R,7R)-7-(methoxymethoxy)-7-methyl-8-tri(propan-2-yl)silyloxyocta-1,5-dien-4-ol.
| Compound Name | (4R,7R)-7-(methoxymethoxy)-7-methyl-8-tri(propan-2-yl)silyloxyocta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 177384026 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (4R,7R)-7-(methoxymethoxy)-7-methyl-8-tri(propan-2-yl)silyloxyocta-1,5-dien-4-ol |
| SMILES | C=CC[C@@H](O)C=C[C@](C)(CO[Si](C(C)C)(C(C)C)C(C)C)OCOC |
| InChI | InChI=1S/C20H40O4Si/c1-10-11-19(21)12-13-20(8,23-15-22-9)14-24-25(16(2)3,17(4)5)18(6)7/h10,12-13,16-19,21H,1,11,14-15H2,2-9H3/t19-,20-/m1/s1 |
| InChIKey | JABIEEKXKCTVST-WOJBJXKFSA-N |
| XLogP | 5.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|