C21H40O5Si — CID 11292529
(4R,5E,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-(2-methoxyethoxymethoxy)-7-methyldeca-1,5,9-trien-4-ol (PubChem CID 11292529) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is (4R,5E,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-(2-methoxyethoxymethoxy)-7-methyldeca-1,5,9-trien-4-ol.
| Compound Name | (4R,5E,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-(2-methoxyethoxymethoxy)-7-methyldeca-1,5,9-trien-4-ol |
|---|---|
| PubChem CID | 11292529 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (4R,5E,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-(2-methoxyethoxymethoxy)-7-methyldeca-1,5,9-trien-4-ol |
| SMILES | C=CC[C@@H](O)/C=C/[C@](C)(O[Si](C)(C)C(C)(C)C)[C@@H](C=C)OCOCCOC |
| InChI | InChI=1S/C21H40O5Si/c1-10-12-18(22)13-14-21(6,26-27(8,9)20(3,4)5)19(11-2)25-17-24-16-15-23-7/h10-11,13-14,18-19,22H,1-2,12,15-17H2,3-9H3/b14-13+/t18-,19-,21+/m1/s1 |
| InChIKey | WPEHVESFOSGFNI-LLQBNWHXSA-N |
| XLogP | 4.45 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|