C18H36O5Si — CID 102360583
(3R,4R,5E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-4-methylhepta-1,5-dien-4-ol (PubChem CID 102360583) has the molecular formula C18H36O5Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (3R,4R,5E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-4-methylhepta-1,5-dien-4-ol.
| Compound Name | (3R,4R,5E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-4-methylhepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 102360583 |
| Molecular Formula | C18H36O5Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (3R,4R,5E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-4-methylhepta-1,5-dien-4-ol |
| SMILES | C=C[C@@H](OCOCCOC)[C@](C)(O)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O5Si/c1-9-16(22-15-21-14-13-20-6)18(5,19)11-10-12-23-24(7,8)17(2,3)4/h9-11,16,19H,1,12-15H2,2-8H3/b11-10+/t16-,18-/m1/s1 |
| InChIKey | MZGUCSLPUAIGET-CDGFNTGHSA-N |
| XLogP | 3.51 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|