C10H15F2NO2 — CID 104858138
2-cyclopent-2-en-1-yl-N-(2,2-difluoro-3-hydroxypropyl)acetamide (PubChem CID 104858138) has the molecular formula C10H15F2NO2 and a molecular weight of 219.23 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-(2,2-difluoro-3-hydroxypropyl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-(2,2-difluoro-3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 104858138 |
| Molecular Formula | C10H15F2NO2 |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-(2,2-difluoro-3-hydroxypropyl)acetamide |
| SMILES | O=C(CC1C=CCC1)NCC(F)(F)CO |
| InChI | InChI=1S/C10H15F2NO2/c11-10(12,7-14)6-13-9(15)5-8-3-1-2-4-8/h1,3,8,14H,2,4-7H2,(H,13,15) |
| InChIKey | VUJKDCUWINLZJG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|