C8H13N5OS — CID 104860902
[(5-methoxy-1,3-dimethylpyrazol-4-yl)methylideneamino]thiourea (PubChem CID 104860902) has the molecular formula C8H13N5OS and a molecular weight of 227.29 g/mol. Its IUPAC name is [(5-methoxy-1,3-dimethylpyrazol-4-yl)methylideneamino]thiourea.
| Compound Name | [(5-methoxy-1,3-dimethylpyrazol-4-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 104860902 |
| Molecular Formula | C8H13N5OS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | [(5-methoxy-1,3-dimethylpyrazol-4-yl)methylideneamino]thiourea |
| SMILES | COc1c(C=NNC(N)=S)c(C)nn1C |
| InChI | InChI=1S/C8H13N5OS/c1-5-6(4-10-11-8(9)15)7(14-3)13(2)12-5/h4H,1-3H3,(H3,9,11,15) |
| InChIKey | DBLUYOBIEBEOSK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|